C14H23ClN2O2 — CID 119910302
1-[2-(2-methoxyphenoxy)ethyl]piperidin-3-amine;hydrochloride (PubChem CID 119910302) has the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenoxy)ethyl]piperidin-3-amine;hydrochloride.
| Compound Name | 1-[2-(2-methoxyphenoxy)ethyl]piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119910302 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-[2-(2-methoxyphenoxy)ethyl]piperidin-3-amine;hydrochloride |
| SMILES | COc1ccccc1OCCN1CCCC(N)C1.Cl |
| InChI | InChI=1S/C14H22N2O2.ClH/c1-17-13-6-2-3-7-14(13)18-10-9-16-8-4-5-12(15)11-16;/h2-3,6-7,12H,4-5,8-11,15H2,1H3;1H |
| InChIKey | ORVUAVTWVIASTE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |