C23H27NO5 — CID 20990461
(Z)-2-(3,4-dimethoxyphenyl)-3-[2-(2-pyrrolidin-1-ylethoxy)phenyl]prop-2-enoic acid (PubChem CID 20990461) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is (Z)-2-(3,4-dimethoxyphenyl)-3-[2-(2-pyrrolidin-1-ylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-(3,4-dimethoxyphenyl)-3-[2-(2-pyrrolidin-1-ylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 20990461 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (Z)-2-(3,4-dimethoxyphenyl)-3-[2-(2-pyrrolidin-1-ylethoxy)phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C(=C/c2ccccc2OCCN2CCCC2)C(=O)O)cc1OC |
| InChI | InChI=1S/C23H27NO5/c1-27-21-10-9-17(16-22(21)28-2)19(23(25)26)15-18-7-3-4-8-20(18)29-14-13-24-11-5-6-12-24/h3-4,7-10,15-16H,5-6,11-14H2,1-2H3,(H,25,26)/b19-15- |
| InChIKey | JKYXFOSSOSFNIY-CYVLTUHYSA-N |
| XLogP | 3.80 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|