C19H21Cl3N2O3S — CID 2215645
1-[3-(2-chlorophenoxy)propyl]-4-(3,4-dichlorophenyl)sulfonylpiperazine (PubChem CID 2215645) has the molecular formula C19H21Cl3N2O3S and a molecular weight of 463.81 g/mol. Its IUPAC name is 1-[3-(2-chlorophenoxy)propyl]-4-(3,4-dichlorophenyl)sulfonylpiperazine.
| Compound Name | 1-[3-(2-chlorophenoxy)propyl]-4-(3,4-dichlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 2215645 |
| Molecular Formula | C19H21Cl3N2O3S |
| Molecular Weight | 463.81 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 1-[3-(2-chlorophenoxy)propyl]-4-(3,4-dichlorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCN(CCCOc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H21Cl3N2O3S/c20-16-7-6-15(14-18(16)22)28(25,26)24-11-9-23(10-12-24)8-3-13-27-19-5-2-1-4-17(19)21/h1-2,4-7,14H,3,8-13H2 |
| InChIKey | FDPPFJIHYZNGCE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.81 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|