C27H36N6O4S — CID 142457488
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[1-[4-(2H-tetrazol-5-yl)phenyl]sulfonylpiperidin-4-yl]pentanamide (PubChem CID 142457488) has the molecular formula C27H36N6O4S and a molecular weight of 540.69 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[1-[4-(2H-tetrazol-5-yl)phenyl]sulfonylpiperidin-4-yl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[1-[4-(2H-tetrazol-5-yl)phenyl]sulfonylpiperidin-4-yl]pentanamide |
|---|---|
| PubChem CID | 142457488 |
| Molecular Formula | C27H36N6O4S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[1-[4-(2H-tetrazol-5-yl)phenyl]sulfonylpiperidin-4-yl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC2CCN(S(=O)(=O)c3ccc(-c4nn[nH]n4)cc3)CC2)c1 |
| InChI | InChI=1S/C27H36N6O4S/c1-19-6-7-20(2)24(18-19)37-17-5-14-27(3,4)26(34)28-22-12-15-33(16-13-22)38(35,36)23-10-8-21(9-11-23)25-29-31-32-30-25/h6-11,18,22H,5,12-17H2,1-4H3,(H,28,34)(H,29,30,31,32) |
| InChIKey | OIERNFYGDHRQKB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|