C24H32N2O6S2 — CID 174927251
[4-[4-[4-(2,5-dimethylphenoxy)butanoylamino]piperidin-1-yl]sulfonylphenyl]methanesulfinic acid (PubChem CID 174927251) has the molecular formula C24H32N2O6S2 and a molecular weight of 508.66 g/mol. Its IUPAC name is [4-[4-[4-(2,5-dimethylphenoxy)butanoylamino]piperidin-1-yl]sulfonylphenyl]methanesulfinic acid.
| Compound Name | [4-[4-[4-(2,5-dimethylphenoxy)butanoylamino]piperidin-1-yl]sulfonylphenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174927251 |
| Molecular Formula | C24H32N2O6S2 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | [4-[4-[4-(2,5-dimethylphenoxy)butanoylamino]piperidin-1-yl]sulfonylphenyl]methanesulfinic acid |
| SMILES | Cc1ccc(C)c(OCCCC(=O)NC2CCN(S(=O)(=O)c3ccc(CS(=O)O)cc3)CC2)c1 |
| InChI | InChI=1S/C24H32N2O6S2/c1-18-5-6-19(2)23(16-18)32-15-3-4-24(27)25-21-11-13-26(14-12-21)34(30,31)22-9-7-20(8-10-22)17-33(28)29/h5-10,16,21H,3-4,11-15,17H2,1-2H3,(H,25,27)(H,28,29) |
| InChIKey | PBKNQKXNGNOJAM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|