C24H32N2O4S — CID 108560906
N-[1-(2,5-dimethylphenyl)sulfonylpiperidin-4-yl]-2-(4-propylphenoxy)acetamide (PubChem CID 108560906) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is N-[1-(2,5-dimethylphenyl)sulfonylpiperidin-4-yl]-2-(4-propylphenoxy)acetamide.
| Compound Name | N-[1-(2,5-dimethylphenyl)sulfonylpiperidin-4-yl]-2-(4-propylphenoxy)acetamide |
|---|---|
| PubChem CID | 108560906 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | N-[1-(2,5-dimethylphenyl)sulfonylpiperidin-4-yl]-2-(4-propylphenoxy)acetamide |
| SMILES | CCCc1ccc(OCC(=O)NC2CCN(S(=O)(=O)c3cc(C)ccc3C)CC2)cc1 |
| InChI | InChI=1S/C24H32N2O4S/c1-4-5-20-8-10-22(11-9-20)30-17-24(27)25-21-12-14-26(15-13-21)31(28,29)23-16-18(2)6-7-19(23)3/h6-11,16,21H,4-5,12-15,17H2,1-3H3,(H,25,27) |
| InChIKey | NXBKFFMRBLUFMB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |