C23H32N2O2S — CID 142458003
4-(2,5-dimethylphenoxy)-N-[1-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpiperidin-4-yl]butanamide (PubChem CID 142458003) has the molecular formula C23H32N2O2S and a molecular weight of 400.59 g/mol. Its IUPAC name is 4-(2,5-dimethylphenoxy)-N-[1-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpiperidin-4-yl]butanamide.
| Compound Name | 4-(2,5-dimethylphenoxy)-N-[1-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpiperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 142458003 |
| Molecular Formula | C23H32N2O2S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 4-(2,5-dimethylphenoxy)-N-[1-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpiperidin-4-yl]butanamide |
| SMILES | C=C/C=C(\C=C)SN1CCC(NC(=O)CCCOc2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C23H32N2O2S/c1-5-8-21(6-2)28-25-14-12-20(13-15-25)24-23(26)9-7-16-27-22-17-18(3)10-11-19(22)4/h5-6,8,10-11,17,20H,1-2,7,9,12-16H2,3-4H3,(H,24,26)/b21-8+ |
| InChIKey | XJVRSHLUPHOHSP-ODCIPOBUSA-N |
| XLogP | 4.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|