C17H25NO2S — CID 78786673
N-cyclopentyl-2-[2-(2,5-dimethylphenoxy)ethylsulfanyl]acetamide (PubChem CID 78786673) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is N-cyclopentyl-2-[2-(2,5-dimethylphenoxy)ethylsulfanyl]acetamide.
| Compound Name | N-cyclopentyl-2-[2-(2,5-dimethylphenoxy)ethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 78786673 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-cyclopentyl-2-[2-(2,5-dimethylphenoxy)ethylsulfanyl]acetamide |
| SMILES | Cc1ccc(C)c(OCCSCC(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C17H25NO2S/c1-13-7-8-14(2)16(11-13)20-9-10-21-12-17(19)18-15-5-3-4-6-15/h7-8,11,15H,3-6,9-10,12H2,1-2H3,(H,18,19) |
| InChIKey | KDHHBZALZANOFT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|