C19H23NO3 — CID 19452624
N-cyclopentyl-5-[(2,5-dimethylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19452624) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-cyclopentyl-5-[(2,5-dimethylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-cyclopentyl-5-[(2,5-dimethylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19452624 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-cyclopentyl-5-[(2,5-dimethylphenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)c(OCc2ccc(C(=O)NC3CCCC3)o2)c1 |
| InChI | InChI=1S/C19H23NO3/c1-13-7-8-14(2)18(11-13)22-12-16-9-10-17(23-16)19(21)20-15-5-3-4-6-15/h7-11,15H,3-6,12H2,1-2H3,(H,20,21) |
| InChIKey | QNJZGHFEIIHIQQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |