C20H25NO3 — CID 35524316
azepan-1-yl-[5-[(2,5-dimethylphenoxy)methyl]furan-2-yl]methanone (PubChem CID 35524316) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is azepan-1-yl-[5-[(2,5-dimethylphenoxy)methyl]furan-2-yl]methanone.
| Compound Name | azepan-1-yl-[5-[(2,5-dimethylphenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 35524316 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | azepan-1-yl-[5-[(2,5-dimethylphenoxy)methyl]furan-2-yl]methanone |
| SMILES | Cc1ccc(C)c(OCc2ccc(C(=O)N3CCCCCC3)o2)c1 |
| InChI | InChI=1S/C20H25NO3/c1-15-7-8-16(2)19(13-15)23-14-17-9-10-18(24-17)20(22)21-11-5-3-4-6-12-21/h7-10,13H,3-6,11-12,14H2,1-2H3 |
| InChIKey | CYXWWLAGLYDPAF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |