C28H39FN2O3 — CID 142457626
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-(1-methylpiperidin-4-yl)pentanamide;4-fluorobenzaldehyde (PubChem CID 142457626) has the molecular formula C28H39FN2O3 and a molecular weight of 470.63 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-(1-methylpiperidin-4-yl)pentanamide;4-fluorobenzaldehyde.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-(1-methylpiperidin-4-yl)pentanamide;4-fluorobenzaldehyde |
|---|---|
| PubChem CID | 142457626 |
| Molecular Formula | C28H39FN2O3 |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-(1-methylpiperidin-4-yl)pentanamide;4-fluorobenzaldehyde |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC2CCN(C)CC2)c1.O=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H34N2O2.C7H5FO/c1-16-7-8-17(2)19(15-16)25-14-6-11-21(3,4)20(24)22-18-9-12-23(5)13-10-18;8-7-3-1-6(5-9)2-4-7/h7-8,15,18H,6,9-14H2,1-5H3,(H,22,24);1-5H |
| InChIKey | SWPHREGKKKWTLN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|