C18H29NO2 — CID 54783506
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-propylpentanamide (PubChem CID 54783506) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-propylpentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-propylpentanamide |
|---|---|
| PubChem CID | 54783506 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-propylpentanamide |
| SMILES | CCCNC(=O)C(C)(C)CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C18H29NO2/c1-6-11-19-17(20)18(4,5)10-7-12-21-16-13-14(2)8-9-15(16)3/h8-9,13H,6-7,10-12H2,1-5H3,(H,19,20) |
| InChIKey | PTTFLUQQFCSAOH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|