C25H32F2N2O6S2 — CID 142457941
5-(2,6-difluorophenoxy)-2,2-dimethyl-N-[1-(3-methylsulfonylphenyl)sulfonylpiperidin-4-yl]pentanamide (PubChem CID 142457941) has the molecular formula C25H32F2N2O6S2 and a molecular weight of 558.67 g/mol. Its IUPAC name is 5-(2,6-difluorophenoxy)-2,2-dimethyl-N-[1-(3-methylsulfonylphenyl)sulfonylpiperidin-4-yl]pentanamide.
| Compound Name | 5-(2,6-difluorophenoxy)-2,2-dimethyl-N-[1-(3-methylsulfonylphenyl)sulfonylpiperidin-4-yl]pentanamide |
|---|---|
| PubChem CID | 142457941 |
| Molecular Formula | C25H32F2N2O6S2 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 5-(2,6-difluorophenoxy)-2,2-dimethyl-N-[1-(3-methylsulfonylphenyl)sulfonylpiperidin-4-yl]pentanamide |
| SMILES | CC(C)(CCCOc1c(F)cccc1F)C(=O)NC1CCN(S(=O)(=O)c2cccc(S(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C25H32F2N2O6S2/c1-25(2,13-6-16-35-23-21(26)9-5-10-22(23)27)24(30)28-18-11-14-29(15-12-18)37(33,34)20-8-4-7-19(17-20)36(3,31)32/h4-5,7-10,17-18H,6,11-16H2,1-3H3,(H,28,30) |
| InChIKey | LTLQZKUJDGFRJC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|