C17H25BrN2O — CID 163349250
N-[1-[(3-bromophenyl)methyl]piperidin-4-yl]-2,2-dimethylpropanamide (PubChem CID 163349250) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is N-[1-[(3-bromophenyl)methyl]piperidin-4-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[1-[(3-bromophenyl)methyl]piperidin-4-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 163349250 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[1-[(3-bromophenyl)methyl]piperidin-4-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC1CCN(Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C17H25BrN2O/c1-17(2,3)16(21)19-15-7-9-20(10-8-15)12-13-5-4-6-14(18)11-13/h4-6,11,15H,7-10,12H2,1-3H3,(H,19,21) |
| InChIKey | OPWLBVKCQJMYMK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |