C15H10ClF3N2O2S — CID 19676638
1-(1,3-benzodioxol-5-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]thiourea (PubChem CID 19676638) has the molecular formula C15H10ClF3N2O2S and a molecular weight of 374.77 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19676638 |
| Molecular Formula | C15H10ClF3N2O2S |
| Molecular Weight | 374.77 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1cc(NC(=S)Nc2ccc3c(c2)OCO3)ccc1Cl |
| InChI | InChI=1S/C15H10ClF3N2O2S/c16-11-3-1-8(5-10(11)15(17,18)19)20-14(24)21-9-2-4-12-13(6-9)23-7-22-12/h1-6H,7H2,(H2,20,21,24) |
| InChIKey | VZAMJUHASPBJKI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.77 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|