C19H13BrF3N3O2S — CID 141024677
N-[4-[[3-bromo-4-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 141024677) has the molecular formula C19H13BrF3N3O2S and a molecular weight of 484.30 g/mol. Its IUPAC name is N-[4-[[3-bromo-4-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[3-bromo-4-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 141024677 |
| Molecular Formula | C19H13BrF3N3O2S |
| Molecular Weight | 484.30 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | N-[4-[[3-bromo-4-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=S)Nc2ccc(C(F)(F)F)c(Br)c2)cc1)c1ccco1 |
| InChI | InChI=1S/C19H13BrF3N3O2S/c20-15-10-13(7-8-14(15)19(21,22)23)26-18(29)25-12-5-3-11(4-6-12)24-17(27)16-2-1-9-28-16/h1-10H,(H,24,27)(H2,25,26,29) |
| InChIKey | IBKGSIZDTYEQQZ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.30 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|