C19H13ClF3N3O5S2 — CID 141023436
2-chloro-4-[[4-(furan-2-carbonylamino)phenyl]carbamothioylamino]-3-(trifluoromethyl)benzenesulfonic acid (PubChem CID 141023436) has the molecular formula C19H13ClF3N3O5S2 and a molecular weight of 519.91 g/mol. Its IUPAC name is 2-chloro-4-[[4-(furan-2-carbonylamino)phenyl]carbamothioylamino]-3-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 2-chloro-4-[[4-(furan-2-carbonylamino)phenyl]carbamothioylamino]-3-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 141023436 |
| Molecular Formula | C19H13ClF3N3O5S2 |
| Molecular Weight | 519.91 g/mol |
| Exact Mass | 518.99 |
| IUPAC Name | 2-chloro-4-[[4-(furan-2-carbonylamino)phenyl]carbamothioylamino]-3-(trifluoromethyl)benzenesulfonic acid |
| SMILES | O=C(Nc1ccc(NC(=S)Nc2ccc(S(=O)(=O)O)c(Cl)c2C(F)(F)F)cc1)c1ccco1 |
| InChI | InChI=1S/C19H13ClF3N3O5S2/c20-16-14(33(28,29)30)8-7-12(15(16)19(21,22)23)26-18(32)25-11-5-3-10(4-6-11)24-17(27)13-2-1-9-31-13/h1-9H,(H,24,27)(H2,25,26,32)(H,28,29,30) |
| InChIKey | JCTXXFZABFYHBD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.91 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|