C13H9F3N2O2S — CID 65483387
N-[4-carbamothioyl-3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 65483387) has the molecular formula C13H9F3N2O2S and a molecular weight of 314.29 g/mol. Its IUPAC name is N-[4-carbamothioyl-3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-carbamothioyl-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 65483387 |
| Molecular Formula | C13H9F3N2O2S |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | N-[4-carbamothioyl-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | NC(=S)c1ccc(NC(=O)c2ccco2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H9F3N2O2S/c14-13(15,16)9-6-7(3-4-8(9)11(17)21)18-12(19)10-2-1-5-20-10/h1-6H,(H2,17,21)(H,18,19) |
| InChIKey | DYZTYPHBILXVHF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|