C22H30F3N3O2S — CID 134952914
ethyl 4-[[(1R,2R)-2-piperidin-1-ylcyclohexyl]carbamothioylamino]-2-(trifluoromethyl)benzoate (PubChem CID 134952914) has the molecular formula C22H30F3N3O2S and a molecular weight of 457.56 g/mol. Its IUPAC name is ethyl 4-[[(1R,2R)-2-piperidin-1-ylcyclohexyl]carbamothioylamino]-2-(trifluoromethyl)benzoate.
| Compound Name | ethyl 4-[[(1R,2R)-2-piperidin-1-ylcyclohexyl]carbamothioylamino]-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 134952914 |
| Molecular Formula | C22H30F3N3O2S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | ethyl 4-[[(1R,2R)-2-piperidin-1-ylcyclohexyl]carbamothioylamino]-2-(trifluoromethyl)benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)N[C@@H]2CCCC[C@H]2N2CCCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H30F3N3O2S/c1-2-30-20(29)16-11-10-15(14-17(16)22(23,24)25)26-21(31)27-18-8-4-5-9-19(18)28-12-6-3-7-13-28/h10-11,14,18-19H,2-9,12-13H2,1H3,(H2,26,27,31)/t18-,19-/m1/s1 |
| InChIKey | MEJDMCWWHJXHDU-RTBURBONSA-N |
| XLogP | 4.97 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|