C20H21ClN2O2S — CID 133215221
ethyl 2-chloro-4-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamothioylamino)benzoate (PubChem CID 133215221) has the molecular formula C20H21ClN2O2S and a molecular weight of 388.92 g/mol. Its IUPAC name is ethyl 2-chloro-4-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamothioylamino)benzoate.
| Compound Name | ethyl 2-chloro-4-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 133215221 |
| Molecular Formula | C20H21ClN2O2S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | ethyl 2-chloro-4-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamothioylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NC2CCCc3ccccc32)cc1Cl |
| InChI | InChI=1S/C20H21ClN2O2S/c1-2-25-19(24)16-11-10-14(12-17(16)21)22-20(26)23-18-9-5-7-13-6-3-4-8-15(13)18/h3-4,6,8,10-12,18H,2,5,7,9H2,1H3,(H2,22,23,26) |
| InChIKey | KJGSICGOKVVQCR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|