C17H16F2N2S — CID 133214458
1-(3,4-difluorophenyl)-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea (PubChem CID 133214458) has the molecular formula C17H16F2N2S and a molecular weight of 318.39 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea.
| Compound Name | 1-(3,4-difluorophenyl)-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea |
|---|---|
| PubChem CID | 133214458 |
| Molecular Formula | C17H16F2N2S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea |
| SMILES | Fc1ccc(NC(=S)NC2CCCc3ccccc32)cc1F |
| InChI | InChI=1S/C17H16F2N2S/c18-14-9-8-12(10-15(14)19)20-17(22)21-16-7-3-5-11-4-1-2-6-13(11)16/h1-2,4,6,8-10,16H,3,5,7H2,(H2,20,21,22) |
| InChIKey | VZMDWZMTLWILDI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|