C11H15N3S — CID 62304428
1-amino-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea (PubChem CID 62304428) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 1-amino-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea.
| Compound Name | 1-amino-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea |
|---|---|
| PubChem CID | 62304428 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1-amino-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea |
| SMILES | NNC(=S)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C11H15N3S/c12-14-11(15)13-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7,12H2,(H2,13,14,15) |
| InChIKey | YPLGIKXNRITIAO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|