C15H22N2S — CID 7744929
1-butyl-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea (PubChem CID 7744929) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 1-butyl-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea.
| Compound Name | 1-butyl-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea |
|---|---|
| PubChem CID | 7744929 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-butyl-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea |
| SMILES | CCCCNC(=S)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C15H22N2S/c1-2-3-11-16-15(18)17-14-10-6-8-12-7-4-5-9-13(12)14/h4-5,7,9,14H,2-3,6,8,10-11H2,1H3,(H2,16,17,18)/t14-/m1/s1 |
| InChIKey | XDICHCFPTIOMOZ-CQSZACIVSA-N |
| XLogP | 3.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|