C19H22N2S — CID 59088084
1-(1,2,3,4-tetrahydronaphthalen-1-yl)-3-[[4-(tritiomethyl)phenyl]methyl]thiourea (PubChem CID 59088084) has the molecular formula C19H22N2S and a molecular weight of 312.47 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-1-yl)-3-[[4-(tritiomethyl)phenyl]methyl]thiourea.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)-3-[[4-(tritiomethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 59088084 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)-3-[[4-(tritiomethyl)phenyl]methyl]thiourea |
| SMILES | [3H]Cc1ccc(CNC(=S)NC2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C19H22N2S/c1-14-9-11-15(12-10-14)13-20-19(22)21-18-8-4-6-16-5-2-3-7-17(16)18/h2-3,5,7,9-12,18H,4,6,8,13H2,1H3,(H2,20,21,22)/i1T |
| InChIKey | JODOJKKXGLNBCK-CNRUNOGKSA-N |
| XLogP | 4.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|