C16H17N3S — CID 23738634
1-(2,3-dihydro-1H-inden-1-yl)-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 23738634) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 23738634 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | S=C(NCc1cccnc1)NC1CCc2ccccc21 |
| InChI | InChI=1S/C16H17N3S/c20-16(18-11-12-4-3-9-17-10-12)19-15-8-7-13-5-1-2-6-14(13)15/h1-6,9-10,15H,7-8,11H2,(H2,18,19,20) |
| InChIKey | VCGYPXKIUWTKTC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|