C20H24N2S — CID 2441518
1-(2-propan-2-ylphenyl)-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea (PubChem CID 2441518) has the molecular formula C20H24N2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 1-(2-propan-2-ylphenyl)-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea.
| Compound Name | 1-(2-propan-2-ylphenyl)-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea |
|---|---|
| PubChem CID | 2441518 |
| Molecular Formula | C20H24N2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-(2-propan-2-ylphenyl)-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea |
| SMILES | CC(C)c1ccccc1NC(=S)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H24N2S/c1-14(2)16-10-5-6-12-18(16)21-20(23)22-19-13-7-9-15-8-3-4-11-17(15)19/h3-6,8,10-12,14,19H,7,9,13H2,1-2H3,(H2,21,22,23)/t19-/m1/s1 |
| InChIKey | JEXPOMGUIQSBSC-LJQANCHMSA-N |
| XLogP | 5.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|