C18H20N2OS — CID 3723161
1-(2,3-dihydro-1H-inden-1-yl)-3-(2-ethoxyphenyl)thiourea (PubChem CID 3723161) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)-3-(2-ethoxyphenyl)thiourea.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-(2-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3723161 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-(2-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccccc1NC(=S)NC1CCc2ccccc21 |
| InChI | InChI=1S/C18H20N2OS/c1-2-21-17-10-6-5-9-16(17)20-18(22)19-15-12-11-13-7-3-4-8-14(13)15/h3-10,15H,2,11-12H2,1H3,(H2,19,20,22) |
| InChIKey | UHEAWFKEGLDGHU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|