C18H18F2N2S2 — CID 2453667
1-[4-(difluoromethylsulfanyl)phenyl]-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea (PubChem CID 2453667) has the molecular formula C18H18F2N2S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea |
|---|---|
| PubChem CID | 2453667 |
| Molecular Formula | C18H18F2N2S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea |
| SMILES | FC(F)Sc1ccc(NC(=S)N[C@@H]2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H18F2N2S2/c19-17(20)24-14-10-8-13(9-11-14)21-18(23)22-16-7-3-5-12-4-1-2-6-15(12)16/h1-2,4,6,8-11,16-17H,3,5,7H2,(H2,21,22,23)/t16-/m1/s1 |
| InChIKey | JTCKHOQYGMGSSN-MRXNPFEDSA-N |
| XLogP | 5.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|