C24H24N2S2 — CID 100641359
1-[4-(phenylsulfanylmethyl)phenyl]-3-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea (PubChem CID 100641359) has the molecular formula C24H24N2S2 and a molecular weight of 404.60 g/mol. Its IUPAC name is 1-[4-(phenylsulfanylmethyl)phenyl]-3-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea.
| Compound Name | 1-[4-(phenylsulfanylmethyl)phenyl]-3-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea |
|---|---|
| PubChem CID | 100641359 |
| Molecular Formula | C24H24N2S2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-[4-(phenylsulfanylmethyl)phenyl]-3-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea |
| SMILES | S=C(Nc1ccc(CSc2ccccc2)cc1)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C24H24N2S2/c27-24(26-23-12-6-8-19-7-4-5-11-22(19)23)25-20-15-13-18(14-16-20)17-28-21-9-2-1-3-10-21/h1-5,7,9-11,13-16,23H,6,8,12,17H2,(H2,25,26,27)/t23-/m0/s1 |
| InChIKey | LQHMZOJLATXIGS-QHCPKHFHSA-N |
| XLogP | 6.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|