C20H22N2OS — CID 100642206
1-(3-prop-2-enoxyphenyl)-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea (PubChem CID 100642206) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is 1-(3-prop-2-enoxyphenyl)-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea.
| Compound Name | 1-(3-prop-2-enoxyphenyl)-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea |
|---|---|
| PubChem CID | 100642206 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-(3-prop-2-enoxyphenyl)-3-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea |
| SMILES | C=CCOc1cccc(NC(=S)N[C@@H]2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C20H22N2OS/c1-2-13-23-17-10-6-9-16(14-17)21-20(24)22-19-12-5-8-15-7-3-4-11-18(15)19/h2-4,6-7,9-11,14,19H,1,5,8,12-13H2,(H2,21,22,24)/t19-/m1/s1 |
| InChIKey | YOTQKZCUUXWWEN-LJQANCHMSA-N |
| XLogP | 4.62 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|