C19H22N2OS — CID 100728030
1-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3-methylphenyl)thiourea (PubChem CID 100728030) has the molecular formula C19H22N2OS and a molecular weight of 326.47 g/mol. Its IUPAC name is 1-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 100728030 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3-methylphenyl)thiourea |
| SMILES | COc1ccc2c(c1)CCC[C@@H]2NC(=S)Nc1cccc(C)c1 |
| InChI | InChI=1S/C19H22N2OS/c1-13-5-3-7-15(11-13)20-19(23)21-18-8-4-6-14-12-16(22-2)9-10-17(14)18/h3,5,7,9-12,18H,4,6,8H2,1-2H3,(H2,20,21,23)/t18-/m0/s1 |
| InChIKey | DVXCONCDQRJETF-SFHVURJKSA-N |
| XLogP | 4.37 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|