C18H19BrN2OS — CID 133216340
1-(3-bromophenyl)-3-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)thiourea (PubChem CID 133216340) has the molecular formula C18H19BrN2OS and a molecular weight of 391.33 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)thiourea.
| Compound Name | 1-(3-bromophenyl)-3-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)thiourea |
|---|---|
| PubChem CID | 133216340 |
| Molecular Formula | C18H19BrN2OS |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 1-(3-bromophenyl)-3-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)thiourea |
| SMILES | COc1ccc2c(c1)CCCC2NC(=S)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C18H19BrN2OS/c1-22-15-8-9-16-12(10-15)4-2-7-17(16)21-18(23)20-14-6-3-5-13(19)11-14/h3,5-6,8-11,17H,2,4,7H2,1H3,(H2,20,21,23) |
| InChIKey | CFDLFKHWBACMRH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|