C21H26N2O2S — CID 133216380
1-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(3-propan-2-yloxyphenyl)thiourea (PubChem CID 133216380) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(3-propan-2-yloxyphenyl)thiourea.
| Compound Name | 1-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(3-propan-2-yloxyphenyl)thiourea |
|---|---|
| PubChem CID | 133216380 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(3-propan-2-yloxyphenyl)thiourea |
| SMILES | COc1ccc2c(c1)CCCC2NC(=S)Nc1cccc(OC(C)C)c1 |
| InChI | InChI=1S/C21H26N2O2S/c1-14(2)25-18-8-5-7-16(13-18)22-21(26)23-20-9-4-6-15-12-17(24-3)10-11-19(15)20/h5,7-8,10-14,20H,4,6,9H2,1-3H3,(H2,22,23,26) |
| InChIKey | KUTSQHKSNOVZAI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|