C21H26N2OS — CID 100728152
1-[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 100728152) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 100728152 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | COc1ccc2c(c1)CCC[C@H]2NC(=S)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H26N2OS/c1-14(2)15-7-9-17(10-8-15)22-21(25)23-20-6-4-5-16-13-18(24-3)11-12-19(16)20/h7-14,20H,4-6H2,1-3H3,(H2,22,23,25)/t20-/m1/s1 |
| InChIKey | DAMDHEZIPNOFBA-HXUWFJFHSA-N |
| XLogP | 5.18 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|