C20H21ClN2O3S — CID 100728860
methyl 4-chloro-3-[[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]carbamothioylamino]benzoate (PubChem CID 100728860) has the molecular formula C20H21ClN2O3S and a molecular weight of 404.92 g/mol. Its IUPAC name is methyl 4-chloro-3-[[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]carbamothioylamino]benzoate.
| Compound Name | methyl 4-chloro-3-[[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100728860 |
| Molecular Formula | C20H21ClN2O3S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | methyl 4-chloro-3-[[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=S)N[C@H]2CCCc3cc(OC)ccc32)c1 |
| InChI | InChI=1S/C20H21ClN2O3S/c1-25-14-7-8-15-12(10-14)4-3-5-17(15)22-20(27)23-18-11-13(19(24)26-2)6-9-16(18)21/h6-11,17H,3-5H2,1-2H3,(H2,22,23,27)/t17-/m0/s1 |
| InChIKey | LZEFQUFLCCYCGY-KRWDZBQOSA-N |
| XLogP | 4.50 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|