C19H19F3N2OS — CID 100728721
1-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 100728721) has the molecular formula C19H19F3N2OS and a molecular weight of 380.44 g/mol. Its IUPAC name is 1-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100728721 |
| Molecular Formula | C19H19F3N2OS |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | COc1ccc2c(c1)CCC[C@@H]2NC(=S)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F3N2OS/c1-25-15-9-10-16-12(11-15)3-2-4-17(16)24-18(26)23-14-7-5-13(6-8-14)19(20,21)22/h5-11,17H,2-4H2,1H3,(H2,23,24,26)/t17-/m0/s1 |
| InChIKey | HUPYTFZXEWPVHM-KRWDZBQOSA-N |
| XLogP | 5.08 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|