C16H21ClN2O2S — CID 100583084
ethyl 2-chloro-5-(cyclohexylcarbamothioylamino)benzoate (PubChem CID 100583084) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is ethyl 2-chloro-5-(cyclohexylcarbamothioylamino)benzoate.
| Compound Name | ethyl 2-chloro-5-(cyclohexylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 100583084 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | ethyl 2-chloro-5-(cyclohexylcarbamothioylamino)benzoate |
| SMILES | CCOC(=O)c1cc(NC(=S)NC2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C16H21ClN2O2S/c1-2-21-15(20)13-10-12(8-9-14(13)17)19-16(22)18-11-6-4-3-5-7-11/h8-11H,2-7H2,1H3,(H2,18,19,22) |
| InChIKey | AZAILNMSZOUCLI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|