C18H20F6N2O — CID 58063002
N-[(1R,2S)-2-pyrrolidin-1-ylcyclopentyl]-2,4-bis(trifluoromethyl)benzamide (PubChem CID 58063002) has the molecular formula C18H20F6N2O and a molecular weight of 394.36 g/mol. Its IUPAC name is N-[(1R,2S)-2-pyrrolidin-1-ylcyclopentyl]-2,4-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(1R,2S)-2-pyrrolidin-1-ylcyclopentyl]-2,4-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58063002 |
| Molecular Formula | C18H20F6N2O |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[(1R,2S)-2-pyrrolidin-1-ylcyclopentyl]-2,4-bis(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@@H]1CCC[C@@H]1N1CCCC1)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C18H20F6N2O/c19-17(20,21)11-6-7-12(13(10-11)18(22,23)24)16(27)25-14-4-3-5-15(14)26-8-1-2-9-26/h6-7,10,14-15H,1-5,8-9H2,(H,25,27)/t14-,15+/m1/s1 |
| InChIKey | VXXKVRCFCBIDKU-CABCVRRESA-N |
| XLogP | 4.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |