C18H23F3N2O2S — CID 154462356
2-methylsulfanyl-N-(4-pyrrolidin-1-yloxan-3-yl)-4-(trifluoromethyl)benzamide (PubChem CID 154462356) has the molecular formula C18H23F3N2O2S and a molecular weight of 388.46 g/mol. Its IUPAC name is 2-methylsulfanyl-N-(4-pyrrolidin-1-yloxan-3-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | 2-methylsulfanyl-N-(4-pyrrolidin-1-yloxan-3-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 154462356 |
| Molecular Formula | C18H23F3N2O2S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-methylsulfanyl-N-(4-pyrrolidin-1-yloxan-3-yl)-4-(trifluoromethyl)benzamide |
| SMILES | CSc1cc(C(F)(F)F)ccc1C(=O)NC1COCCC1N1CCCC1 |
| InChI | InChI=1S/C18H23F3N2O2S/c1-26-16-10-12(18(19,20)21)4-5-13(16)17(24)22-14-11-25-9-6-15(14)23-7-2-3-8-23/h4-5,10,14-15H,2-3,6-9,11H2,1H3,(H,22,24) |
| InChIKey | SEMDLZLBWLBMBS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |