C21H25F3N2O3 — CID 77445013
2-cyclopropyl-N-[4-(4-oxopiperidin-1-yl)oxan-3-yl]-4-(trifluoromethyl)benzamide (PubChem CID 77445013) has the molecular formula C21H25F3N2O3 and a molecular weight of 410.44 g/mol. Its IUPAC name is 2-cyclopropyl-N-[4-(4-oxopiperidin-1-yl)oxan-3-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-cyclopropyl-N-[4-(4-oxopiperidin-1-yl)oxan-3-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 77445013 |
| Molecular Formula | C21H25F3N2O3 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-cyclopropyl-N-[4-(4-oxopiperidin-1-yl)oxan-3-yl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C1CCN(C2CCOCC2NC(=O)c2ccc(C(F)(F)F)cc2C2CC2)CC1 |
| InChI | InChI=1S/C21H25F3N2O3/c22-21(23,24)14-3-4-16(17(11-14)13-1-2-13)20(28)25-18-12-29-10-7-19(18)26-8-5-15(27)6-9-26/h3-4,11,13,18-19H,1-2,5-10,12H2,(H,25,28) |
| InChIKey | NQXPEBKXQSOMLP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |