C19H25F3N2O2 — CID 162560705
2,6-dimethyl-N-[(4S)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide (PubChem CID 162560705) has the molecular formula C19H25F3N2O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is 2,6-dimethyl-N-[(4S)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2,6-dimethyl-N-[(4S)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 162560705 |
| Molecular Formula | C19H25F3N2O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2,6-dimethyl-N-[(4S)-4-pyrrolidin-1-yloxan-3-yl]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(C(F)(F)F)cc(C)c1C(=O)NC1COCC[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C19H25F3N2O2/c1-12-9-14(19(20,21)22)10-13(2)17(12)18(25)23-15-11-26-8-5-16(15)24-6-3-4-7-24/h9-10,15-16H,3-8,11H2,1-2H3,(H,23,25)/t15?,16-/m0/s1 |
| InChIKey | MADMGRSONIGUEX-LYKKTTPLSA-N |
| XLogP | 3.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |