C20H27F3N2O — CID 51001073
2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide (PubChem CID 51001073) has the molecular formula C20H27F3N2O and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 51001073 |
| Molecular Formula | C20H27F3N2O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCc1cc(C(F)(F)F)ccc1C(=O)N[C@@H]1CCCC[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C20H27F3N2O/c1-2-14-13-15(20(21,22)23)9-10-16(14)19(26)24-17-7-3-4-8-18(17)25-11-5-6-12-25/h9-10,13,17-18H,2-8,11-12H2,1H3,(H,24,26)/t17-,18+/m1/s1 |
| InChIKey | VDAGRLZAUOLEMS-MSOLQXFVSA-N |
| XLogP | 4.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |