About 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide
2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide (PubChem CID 51001073) has the molecular formula C20H27F3N2O
and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide |
| PubChem CID | 51001073 |
| Molecular Formula | C20H27F3N2O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCc1cc(C(F)(F)F)ccc1C(=O)N[C@@H]1CCCC[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C20H27F3N2O/c1-2-14-13-15(20(21,22)23)9-10-16(14)19(26)24-17-7-3-4-8-18(17)25-11-5-6-12-25/h9-10,13,17-18H,2-8,11-12H2,1H3,(H,24,26)/t17-,18+/m1/s1 |
| InChIKey | VDAGRLZAUOLEMS-MSOLQXFVSA-N |
| XLogP | 4.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide?
The IUPAC name of 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide (CID 51001073) is 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide.
What is the SMILES notation for 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide?
The canonical SMILES for 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide is CCc1cc(C(F)(F)F)ccc1C(=O)N[C@@H]1CCCC[C@@H]1N1CCCC1.
What is the InChIKey of 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide?
The InChIKey is VDAGRLZAUOLEMS-MSOLQXFVSA-N. The full InChI is InChI=1S/C20H27F3N2O/c1-2-14-13-15(20(21,22)23)9-10-16(14)19(26)24-17-7-3-4-8-18(17)25-11-5-6-12-25/h9-10,13,17-18H,2-8,11-12H2,1H3,(H,24,26)/t17-,18+/m1/s1.
What are the key properties of 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide?
2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide has a molecular weight of 368.44 g/mol, XLogP of 4.40, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]-4-(trifluoromethyl)benzamide is sourced from PubChem (CID 51001073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).