C11H13F3N2OS — CID 43320770
4-(2-methoxyethylamino)-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 43320770) has the molecular formula C11H13F3N2OS and a molecular weight of 278.30 g/mol. Its IUPAC name is 4-(2-methoxyethylamino)-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-(2-methoxyethylamino)-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 43320770 |
| Molecular Formula | C11H13F3N2OS |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 4-(2-methoxyethylamino)-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | COCCNc1ccc(C(N)=S)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2OS/c1-17-5-4-16-7-2-3-8(10(15)18)9(6-7)11(12,13)14/h2-3,6,16H,4-5H2,1H3,(H2,15,18) |
| InChIKey | HWMMJJJXOPBPRA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|