C15H13F3N2S — CID 43320804
4-(4-methylanilino)-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 43320804) has the molecular formula C15H13F3N2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 4-(4-methylanilino)-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-(4-methylanilino)-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 43320804 |
| Molecular Formula | C15H13F3N2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-(4-methylanilino)-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | Cc1ccc(Nc2ccc(C(N)=S)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H13F3N2S/c1-9-2-4-10(5-3-9)20-11-6-7-12(14(19)21)13(8-11)15(16,17)18/h2-8,20H,1H3,(H2,19,21) |
| InChIKey | ALYOPBRQEKJATC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|