C14H10F3IN2S — CID 43320820
4-(3-iodoanilino)-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 43320820) has the molecular formula C14H10F3IN2S and a molecular weight of 422.21 g/mol. Its IUPAC name is 4-(3-iodoanilino)-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-(3-iodoanilino)-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 43320820 |
| Molecular Formula | C14H10F3IN2S |
| Molecular Weight | 422.21 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | 4-(3-iodoanilino)-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Nc2cccc(I)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H10F3IN2S/c15-14(16,17)12-7-10(4-5-11(12)13(19)21)20-9-3-1-2-8(18)6-9/h1-7,20H,(H2,19,21) |
| InChIKey | INGQXMSSEMMURG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.21 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|