C13H15F3N2S — CID 43533580
4-(1-cyclopropylethylamino)-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 43533580) has the molecular formula C13H15F3N2S and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-(1-cyclopropylethylamino)-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-(1-cyclopropylethylamino)-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 43533580 |
| Molecular Formula | C13H15F3N2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-(1-cyclopropylethylamino)-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CC(Nc1ccc(C(N)=S)c(C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C13H15F3N2S/c1-7(8-2-3-8)18-9-4-5-10(12(17)19)11(6-9)13(14,15)16/h4-8,18H,2-3H2,1H3,(H2,17,19) |
| InChIKey | IHHCFLYMWWKTRN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|