C13H16F3N3OS — CID 61467852
2-[4-carbamothioyl-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide (PubChem CID 61467852) has the molecular formula C13H16F3N3OS and a molecular weight of 319.35 g/mol. Its IUPAC name is 2-[4-carbamothioyl-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide.
| Compound Name | 2-[4-carbamothioyl-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 61467852 |
| Molecular Formula | C13H16F3N3OS |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-[4-carbamothioyl-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide |
| SMILES | CC(Nc1ccc(C(N)=S)c(C(F)(F)F)c1)C(=O)N(C)C |
| InChI | InChI=1S/C13H16F3N3OS/c1-7(12(20)19(2)3)18-8-4-5-9(11(17)21)10(6-8)13(14,15)16/h4-7,18H,1-3H3,(H2,17,21) |
| InChIKey | WXTPCAZGPHFGNT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|