C13H13F3N4S — CID 43138612
4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 43138612) has the molecular formula C13H13F3N4S and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 43138612 |
| Molecular Formula | C13H13F3N4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | Cc1cc(Nc2ccc(C(N)=S)c(C(F)(F)F)c2)n(C)n1 |
| InChI | InChI=1S/C13H13F3N4S/c1-7-5-11(20(2)19-7)18-8-3-4-9(12(17)21)10(6-8)13(14,15)16/h3-6,18H,1-2H3,(H2,17,21) |
| InChIKey | OELSJRJFWMWGMV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|