C12H17BrN2OS — CID 107277648
2-bromo-4-(4-methoxybutylamino)benzenecarbothioamide (PubChem CID 107277648) has the molecular formula C12H17BrN2OS and a molecular weight of 317.25 g/mol. Its IUPAC name is 2-bromo-4-(4-methoxybutylamino)benzenecarbothioamide.
| Compound Name | 2-bromo-4-(4-methoxybutylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107277648 |
| Molecular Formula | C12H17BrN2OS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-bromo-4-(4-methoxybutylamino)benzenecarbothioamide |
| SMILES | COCCCCNc1ccc(C(N)=S)c(Br)c1 |
| InChI | InChI=1S/C12H17BrN2OS/c1-16-7-3-2-6-15-9-4-5-10(12(14)17)11(13)8-9/h4-5,8,15H,2-3,6-7H2,1H3,(H2,14,17) |
| InChIKey | PPPWMWAKHADFFX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|