C12H17BrN2O2S — CID 114100259
2-bromo-4-(2,3-dimethoxypropylamino)benzenecarbothioamide (PubChem CID 114100259) has the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. Its IUPAC name is 2-bromo-4-(2,3-dimethoxypropylamino)benzenecarbothioamide.
| Compound Name | 2-bromo-4-(2,3-dimethoxypropylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 114100259 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-bromo-4-(2,3-dimethoxypropylamino)benzenecarbothioamide |
| SMILES | COCC(CNc1ccc(C(N)=S)c(Br)c1)OC |
| InChI | InChI=1S/C12H17BrN2O2S/c1-16-7-9(17-2)6-15-8-3-4-10(12(14)18)11(13)5-8/h3-5,9,15H,6-7H2,1-2H3,(H2,14,18) |
| InChIKey | SLXGYAWLZMGGGE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|